What is the TRANS-2-METHYL-1,3-PENTADIENE?

TRANS-2-METHYL-1,3-PENTADIENE is , while it's Molecular Formula is C6H10. Used in Chemical Industry: TRANS-2-METHYL-1,3-PENTADIENE is utilized as a starting material for various chemical synthesis procedures. Its unique structure with double bonds and a methyl group makes it a valuable component in the creation of different chemical products. Due to the limited information provided in the materials, the specific applications and industries where TRANS-2-METHYL-1,3-PENTADIENE is used are not detailed. However, its role as a starting material in chemical synthesis suggests that it could be employed across a range of industries that rely on chemical manufacturing, such as pharmaceuticals, materials science, and specialty chemicals production.

What is the CAS number for TRANS-2-METHYL-1,3-PENTADIENE?

The CAS number of TRANS-2-METHYL-1,3-PENTADIENE is 1118-58-7.

What is TRANS-2-METHYL-1,3-PENTADIENE (1118-58-7) used for?

TRANS-2-METHYL-1,3-PENTADIENE is an organic compound characterized by a five-carbon chain with a methyl group attached and two carbon-carbon double bonds located at the 1st and 3rd positions. It is isomeric, which means it can exist in different forms with the same chemical formula but distinct molecular structures. TRANS-2-METHYL-1,3-PENTADIENE is known for its reactivity and should be handled cautiously due to its potential to cause skin and eye irritation.InChI:InChI=1/C6H10/c1-4-5-6(2)3/h4-5H,2H2,1,3H3/b5-4+

What is the TRANS-2-METHYL-1,3-PENTADIENE?

TRANS-2-METHYL-1,3-PENTADIENE is , while it's Molecular Formula is C6H10. Used in Chemical Industry: TRANS-2-METHYL-1,3-PENTADIENE is utilized as a starting material for various chemical synthesis procedures. Its unique structure with double bonds and a methyl group makes it a valuable component in the creation of different chemical products. Due to the limited information provided in the materials, the specific applications and industries where TRANS-2-METHYL-1,3-PENTADIENE is used are not detailed. However, its role as a starting material in chemical synthesis suggests that it could be employed across a range of industries that rely on chemical manufacturing, such as pharmaceuticals, materials science, and specialty chemicals production.

What is the CAS number for TRANS-2-METHYL-1,3-PENTADIENE?

The CAS number of TRANS-2-METHYL-1,3-PENTADIENE is 1118-58-7.

What is TRANS-2-METHYL-1,3-PENTADIENE (1118-58-7) used for?

TRANS-2-METHYL-1,3-PENTADIENE is an organic compound characterized by a five-carbon chain with a methyl group attached and two carbon-carbon double bonds located at the 1st and 3rd positions. It is isomeric, which means it can exist in different forms with the same chemical formula but distinct molecular structures. TRANS-2-METHYL-1,3-PENTADIENE is known for its reactivity and should be handled cautiously due to its potential to cause skin and eye irritation.InChI:InChI=1/C6H10/c1-4-5-6(2)3/h4-5H,2H2,1,3H3/b5-4+

Product Center

Current location：Home > Product Center > TRANS-2-METHYL-1,3-PENTADIENE

TRANS-2-METHYL-1,3-PENTADIENE

Name TRANS-2-METHYL-1,3-PENTADIENE
CAS 1118-58-7
Purity 99%

Inquiry

Product Details

Cost-effective and customizable TRANS-2-METHYL-1,3-PENTADIENE 1118-58-7 in stock

Molecular Formula: C6H10
Molecular Weight: 82.1454
Vapor Pressure: 113mmHg at 25°C
Melting Point: -14.9°C
Refractive Index: n20/D 1.451
Boiling Point: 75-76 °C(lit.)
Flash Point: -10 °C
PSA： 0.00000
Density: 0,72 g/cm3
LogP: 2.13860

TRANS-2-METHYL-1,3-PENTADIENE(Cas 1118-58-7) Usage

General Description

Trans-2-Methyl-1,3-Pentadiene is an organic compound that consists of a five-carbon chain with one methyl group attached and two carbon-carbon double bonds positioned at the 1st and 3rd positions on the chain. It's isomeric, meaning it can exist in multiple forms that have the same chemical formula but different molecular structures. TRANS-2-METHYL-1,3-PENTADIENE is used in the chemical industry as a starting material for various chemical synthesis procedures. However, it should be handled with care due to its reactivity and potential to be a skin and eye irritant.

InChI:InChI=1/C6H10/c1-4-5-6(2)3/h4-5H,2H2,1,3H3/b5-4+